Content-Length: 231990 | pFad | http://sh.wikipedia.org/wiki/Befunolol

Befunolol – Wikipedija/Википедија Prijeđi na sadržaj

Befunolol

Izvor: Wikipedija
Befunolol
(IUPAC) ime
(RS)-17-[2-hidroksi-3-(propan-2-ilamino)propoksi]- 1-benzofuran-2-il
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

etanon

| image = Befunolol.svg | width = | image2 = | width2 =

| tradename = Benfuran, Bentos, Betaclar, Glauconex | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CASNo_Ref =  DaY | CAS_number_Ref =  DaY | CAS_number = 39552-01-7 | ATC_prefix = S01 | ATC_suffix = ED06 | PubChem = 2309 | IUPHAR_ligand = | DrugBank_Ref = Šablon:Drugbankcite | DrugBank = | ChemSpiderID_Ref =  DaY | ChemSpiderID = 2219 | UNII_Ref =  DaY | UNII = 418546MT3A | KEGG_Ref =  DaY | KEGG = D07496 | ChEMBL_Ref =  DaY | ChEMBL = 153984

| C=16 | H=21 | N=1 | O=4 | molecular_weight = 291,342 g/mol | smiles = O=C(c2oc1c(OCC(O)CNC(C)C)cccc1c2)C | InChI = 1/C16H21NO4/c1-10(2)17-8-13(19)9-20-14-6-4-5-12-7-15(11(3)18)21-16(12)14/h4-7,10,13,17,19H,8-9H2,1-3H3 | InChIKey = ZPQPDBIHYCBNIG-UHFFFAOYAP | StdInChI_Ref =  DaY | StdInChI = 1S/C16H21NO4/c1-10(2)17-8-13(19)9-20-14-6-4-5-12-7-15(11(3)18)21-16(12)14/h4-7,10,13,17,19H,8-9H2,1-3H3 | StdInChIKey_Ref =  DaY | StdInChIKey = ZPQPDBIHYCBNIG-UHFFFAOYSA-N }} Befunolol je beta blokator sa intrinsičnom simpatomimetičkom aktivnošću koji se koristi u tretmanu glaukoma.[1]

Reference

[uredi | uredi kod]
  1. Stephan Reichl, Christel C Müller-Goymann (2003-02-01). „The use of a porcine organotypic cornea construct for permeation studies from formulations containing befunolol hydrochloride”. International Journal of Pharmaceutics 250 (1): 191–201. 

Vanjske veze

[uredi | uredi kod]








ApplySandwichStrip

pFad - (p)hone/(F)rame/(a)nonymizer/(d)eclutterfier!      Saves Data!


--- a PPN by Garber Painting Akron. With Image Size Reduction included!

Fetched URL: http://sh.wikipedia.org/wiki/Befunolol

Alternative Proxies:

Alternative Proxy

pFad Proxy

pFad v3 Proxy

pFad v4 Proxy