Halogen Derivatives MOP
Halogen Derivatives MOP
00 SB STAR
Hr DT-46
Marks :360
CHEMISTRY
68. In which of the following is/are allylic halides
1. (i) & (ii) 2. (i) & (iii) 3. (ii) & (iv) 4. (ii) & (iii)
69.
Ph – CH2 – CH = CH2 + HBr ?
1. 1–Bromo–3–phenyl propane 2. 2–Bromo–1–phenylpropane
3. 1–Bromo–1–phenyl propane 4. 2–Bromo–2–phenyl propane
70. IUPAC name of isobutyl chloride
1. 1–chloro propane 2. 2–chloro butane
3. 1–chloro–2–methyl propane 4. 2–chloro–2–methyl propane
71. What is the IUPAC name for CH3CHClCH(CH3)CH2CH2CH2CH2Br?
1) 1-bromo-6-chloro-5-methylheptane 2) 7-bromo-2-chloro-3-methylheptane
3) 1-bromo-6-chloro-5,6-dimethylhexane 4) 6-bromo-1-chloro-1,2-dimethylhexane
72. Compound X reacts with HI. The product of this reaction, when treated with KOH in
ethanol, gives Y ( an isomer of X ). Ozonolysis of Y (O3 followed by H2O2) produces two
compounds: a two carbon carboxylic acid, and a four carbon ketone. What is X?
1) 2-methyl-2-pentene 2) 4-methyl-1-pentene
3) 2,3-dimethyl-2-butene 4) 3-methyl-1-pentene
73. How many types of dihalo propanes are obtained from propane on dihalogenation
1. 1 2. 2 3. 3 4. 4
74. In which of the following metal fluoride is not used in Swartz reaction
1. SbF3 2. Hg2F2 3. CoF2 4. SnF2
75. In the preparation of chlorobenzene from aniline, the most suitable reagent is
1. Chlorine in the presence of ultraviolet light 2. Chlorine in the presence of AlCl3
3. Nitrous acid followed by heating with Cu2Cl2 4. HCl and Cu2Cl2
76. The catalyst used in the preparation of an alkyl chloride by the action of dry HCl on an
alcohol is
1. Anhydrous AlCl3 2. FeCl3 3. Anhydrous ZnCl2 4. Cu
77. Reaction of 1,4-dibromobutane with Mg turnings in ether gives the bis-Grignard reagent,
BrMgCH2CH2CH2CH2MgBr. What is the product from the reaction of 2,3-dibromobutane
with Mg under the same conditions?
1) 2-butene 2) 1-butene
3) meso-CH3CH(MgBr)CH(MgBr)CH3 4) racemic-CH3CH(MgBr)CH(MgBr)CH3
78. Finkelstein reaction for the preparation of alkyl iodide is based upon the fact that
1. Sodium iodide is soluble in methanol, while sodium chloride is insoluble in methanol
2. Sodium iodide is soluble in acetone, while NaCl and Na Br are insoluble in acetone
3. Sodium iodide is insoluble in methanol, while NaCl and Na Br are soluble
4. The three halogens differ considerably in their electronegativity
79. Which of the following reagents would not effect the following transformation?
1. 2.
3. 4.
81.
, What is A?
1. Me2CH – CH2Cl 2. MeCH2–CH(Cl)Me 3. (CCl3)2CHCH2Cl 4. (CCl3)2C = O
82.
1) 2)
3) 4)
1. The initially formed carbocation is secondary and it rearranges to the more stable
tertiary one by shift of alkyl group
2. The reaction converts one tertiary carbocation into another to relieve torsional strain
3. The tertiary chloride is much more stable than a secondary one, because of
hyperconjugation
4. This is a radical chain reaction, controlled by relative bond strengths.
14
84. CH3 – CH = CH2 reacts with Cl2 at 5000C. Find out number of possible products.
(including stereoisomers)
1. 1 2. 2 3. 3 4. 4
85. Which of the following has the highest boiling point?
1. 1– Chloropentane 2. Isopently chloride
3. Ter–pentyl chloride 4. All have equal boiling point
86. 3C2H5OH+PCl3 3C2H5Cl+X where ‘X’ is
1. H3PO2 2. H3PO4 3. H3PO3 4. H4P2O7
87. Alkyl halides (except alkyl fluorides) are almost insoluble in water because
1. They are covalent compounds 2. They have low polarity
3. They do not form hydrogen bonds with water 4. They have tetrahedral geometry
88.
3) 4)
89. Which of the following organic halides will undergo an E2 elimination on heating with KOH
in alcohol?
1) 2,2-dimethyl-1-bromopropane 2) 2,2-dimethyl-1-bromocyclohexane
3) benzyl chloride (C6H5CH2Cl) 4) 2,5-dimethyl-1-bromobenzene
90. A C7H13Br compound reacts with KOH in ethanol to form 3-methylcyclohexene as the major
product. What is a likely structure for the starting alkyl bromide?
1) 4-methylcyclohexyl bromide 2) 3-methylcyclohexyl bromide
3) 2-methylcyclohexyl bromide 4) 1-methylcyclohexyl bromide
THE END
KEY
SB STAR DT-46_02-10-23
CHEMISTRY
68) 1 69) 1 70) 3 71) 1 72) 4 73) 4 74) 4 75) 3 76) 3 77) 1
78) 2 79) 1 80) 1 81) 3 82) 1 83) 2 84) 2 85) 1 86) 3 87) 3